About 1-[4-(2,5-dichlorophenyl)sulfonylphenoxy]-8-(trioxidanylsulfanyl)naphthalene
1-[4-(2,5-dichlorophenyl)sulfonylphenoxy]-8-(trioxidanylsulfanyl)naphthalene (PubChem CID 59330951) has the molecular formula C22H14Cl2O6S2
and a molecular weight of 509.39 g/mol. Its IUPAC name is 1-[4-(2,5-dichlorophenyl)sulfonylphenoxy]-8-(trioxidanylsulfanyl)naphthalene.
Molecular Properties
| Compound Name | 1-[4-(2,5-dichlorophenyl)sulfonylphenoxy]-8-(trioxidanylsulfanyl)naphthalene |
| PubChem CID | 59330951 |
| Molecular Formula | C22H14Cl2O6S2 |
| Molecular Weight | 509.39 g/mol |
| Exact Mass | 507.96 |
| IUPAC Name | 1-[4-(2,5-dichlorophenyl)sulfonylphenoxy]-8-(trioxidanylsulfanyl)naphthalene |
| SMILES | O=S(=O)(c1ccc(Oc2cccc3cccc(SOOO)c23)cc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C22H14Cl2O6S2/c23-15-7-12-18(24)21(13-15)32(26,27)17-10-8-16(9-11-17)28-19-5-1-3-14-4-2-6-20(22(14)19)31-30-29-25/h1-13,25H |
| InChIKey | IPDOQILVUBGNFK-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 509.39 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(2,5-dichlorophenyl)sulfonylphenoxy]-8-(trioxidanylsulfanyl)naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2,5-dichlorophenyl)sulfonylphenoxy]-8-(trioxidanylsulfanyl)naphthalene?
The IUPAC name of 1-[4-(2,5-dichlorophenyl)sulfonylphenoxy]-8-(trioxidanylsulfanyl)naphthalene (CID 59330951) is 1-[4-(2,5-dichlorophenyl)sulfonylphenoxy]-8-(trioxidanylsulfanyl)naphthalene.
What is the SMILES notation for 1-[4-(2,5-dichlorophenyl)sulfonylphenoxy]-8-(trioxidanylsulfanyl)naphthalene?
The canonical SMILES for 1-[4-(2,5-dichlorophenyl)sulfonylphenoxy]-8-(trioxidanylsulfanyl)naphthalene is O=S(=O)(c1ccc(Oc2cccc3cccc(SOOO)c23)cc1)c1cc(Cl)ccc1Cl.
What is the InChIKey of 1-[4-(2,5-dichlorophenyl)sulfonylphenoxy]-8-(trioxidanylsulfanyl)naphthalene?
The InChIKey is IPDOQILVUBGNFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14Cl2O6S2/c23-15-7-12-18(24)21(13-15)32(26,27)17-10-8-16(9-11-17)28-19-5-1-3-14-4-2-6-20(22(14)19)31-30-29-25/h1-13,25H.
What are the key properties of 1-[4-(2,5-dichlorophenyl)sulfonylphenoxy]-8-(trioxidanylsulfanyl)naphthalene?
1-[4-(2,5-dichlorophenyl)sulfonylphenoxy]-8-(trioxidanylsulfanyl)naphthalene has a molecular weight of 509.39 g/mol, XLogP of 7.20, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2,5-dichlorophenyl)sulfonylphenoxy]-8-(trioxidanylsulfanyl)naphthalene is sourced from PubChem (CID 59330951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).