About (1-propyl-2,3-dihydroinden-1-yl) 2-methyl-2-(trifluoromethyl)butanoate
(1-propyl-2,3-dihydroinden-1-yl) 2-methyl-2-(trifluoromethyl)butanoate (PubChem CID 59330985) has the molecular formula C18H23F3O2
and a molecular weight of 328.37 g/mol. Its IUPAC name is (1-propyl-2,3-dihydroinden-1-yl) 2-methyl-2-(trifluoromethyl)butanoate.
Molecular Properties
| Compound Name | (1-propyl-2,3-dihydroinden-1-yl) 2-methyl-2-(trifluoromethyl)butanoate |
| PubChem CID | 59330985 |
| Molecular Formula | C18H23F3O2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (1-propyl-2,3-dihydroinden-1-yl) 2-methyl-2-(trifluoromethyl)butanoate |
| SMILES | CCCC1(OC(=O)C(C)(CC)C(F)(F)F)CCc2ccccc21 |
| InChI | InChI=1S/C18H23F3O2/c1-4-11-17(12-10-13-8-6-7-9-14(13)17)23-15(22)16(3,5-2)18(19,20)21/h6-9H,4-5,10-12H2,1-3H3 |
| InChIKey | XAVUUDYPFJIBMX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-propyl-2,3-dihydroinden-1-yl) 2-methyl-2-(trifluoromethyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-propyl-2,3-dihydroinden-1-yl) 2-methyl-2-(trifluoromethyl)butanoate?
The IUPAC name of (1-propyl-2,3-dihydroinden-1-yl) 2-methyl-2-(trifluoromethyl)butanoate (CID 59330985) is (1-propyl-2,3-dihydroinden-1-yl) 2-methyl-2-(trifluoromethyl)butanoate.
What is the SMILES notation for (1-propyl-2,3-dihydroinden-1-yl) 2-methyl-2-(trifluoromethyl)butanoate?
The canonical SMILES for (1-propyl-2,3-dihydroinden-1-yl) 2-methyl-2-(trifluoromethyl)butanoate is CCCC1(OC(=O)C(C)(CC)C(F)(F)F)CCc2ccccc21.
What is the InChIKey of (1-propyl-2,3-dihydroinden-1-yl) 2-methyl-2-(trifluoromethyl)butanoate?
The InChIKey is XAVUUDYPFJIBMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23F3O2/c1-4-11-17(12-10-13-8-6-7-9-14(13)17)23-15(22)16(3,5-2)18(19,20)21/h6-9H,4-5,10-12H2,1-3H3.
What are the key properties of (1-propyl-2,3-dihydroinden-1-yl) 2-methyl-2-(trifluoromethyl)butanoate?
(1-propyl-2,3-dihydroinden-1-yl) 2-methyl-2-(trifluoromethyl)butanoate has a molecular weight of 328.37 g/mol, XLogP of 5.15, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-propyl-2,3-dihydroinden-1-yl) 2-methyl-2-(trifluoromethyl)butanoate is sourced from PubChem (CID 59330985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).