C7H6F10O — CID 59331026
2-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-methylpentan-2-ol (PubChem CID 59331026) has the molecular formula C7H6F10O and a molecular weight of 296.10 g/mol. Its IUPAC name is 2-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-methylpentan-2-ol.
| Compound Name | 2-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 59331026 |
| Molecular Formula | C7H6F10O |
| Molecular Weight | 296.10 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 2-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-methylpentan-2-ol |
| SMILES | CC(C(F)(F)F)C(F)(F)C(O)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H6F10O/c1-2(6(12,13)14)5(10,11)4(18,3(8)9)7(15,16)17/h2-3,18H,1H3 |
| InChIKey | XUJTWLNDDGRKNE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.10 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |