C27H32N6O6S — CID 59332072
2-[5,6-bis(2-methoxyethoxy)-3-oxo-1H-isoindol-2-yl]-N-(4-piperazin-1-yl-3-pyridinyl)-1,3-thiazole-4-carboxamide (PubChem CID 59332072) has the molecular formula C27H32N6O6S and a molecular weight of 568.66 g/mol. Its IUPAC name is 2-[5,6-bis(2-methoxyethoxy)-3-oxo-1H-isoindol-2-yl]-N-(4-piperazin-1-yl-3-pyridinyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[5,6-bis(2-methoxyethoxy)-3-oxo-1H-isoindol-2-yl]-N-(4-piperazin-1-yl-3-pyridinyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59332072 |
| Molecular Formula | C27H32N6O6S |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | 2-[5,6-bis(2-methoxyethoxy)-3-oxo-1H-isoindol-2-yl]-N-(4-piperazin-1-yl-3-pyridinyl)-1,3-thiazole-4-carboxamide |
| SMILES | COCCOc1cc2c(cc1OCCOC)C(=O)N(c1nc(C(=O)Nc3cnccc3N3CCNCC3)cs1)C2 |
| InChI | InChI=1S/C27H32N6O6S/c1-36-9-11-38-23-13-18-16-33(26(35)19(18)14-24(23)39-12-10-37-2)27-31-21(17-40-27)25(34)30-20-15-29-4-3-22(20)32-7-5-28-6-8-32/h3-4,13-15,17,28H,5-12,16H2,1-2H3,(H,30,34) |
| InChIKey | YWNNWMMZRGPJTJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 127.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|