About 7-phenyl-1,4-dioxa-8-thiaspiro[4.5]decane
7-phenyl-1,4-dioxa-8-thiaspiro[4.5]decane (PubChem CID 59332786) has the molecular formula C13H16O2S
and a molecular weight of 236.34 g/mol. Its IUPAC name is 7-phenyl-1,4-dioxa-8-thiaspiro[4.5]decane.
Molecular Properties
| Compound Name | 7-phenyl-1,4-dioxa-8-thiaspiro[4.5]decane |
| PubChem CID | 59332786 |
| Molecular Formula | C13H16O2S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 7-phenyl-1,4-dioxa-8-thiaspiro[4.5]decane |
| SMILES | c1ccc(C2CC3(CCS2)OCCO3)cc1 |
| InChI | InChI=1S/C13H16O2S/c1-2-4-11(5-3-1)12-10-13(6-9-16-12)14-7-8-15-13/h1-5,12H,6-10H2 |
| InChIKey | AMPOORWZGBHTDR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-phenyl-1,4-dioxa-8-thiaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-phenyl-1,4-dioxa-8-thiaspiro[4.5]decane?
The IUPAC name of 7-phenyl-1,4-dioxa-8-thiaspiro[4.5]decane (CID 59332786) is 7-phenyl-1,4-dioxa-8-thiaspiro[4.5]decane.
What is the SMILES notation for 7-phenyl-1,4-dioxa-8-thiaspiro[4.5]decane?
The canonical SMILES for 7-phenyl-1,4-dioxa-8-thiaspiro[4.5]decane is c1ccc(C2CC3(CCS2)OCCO3)cc1.
What is the InChIKey of 7-phenyl-1,4-dioxa-8-thiaspiro[4.5]decane?
The InChIKey is AMPOORWZGBHTDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2S/c1-2-4-11(5-3-1)12-10-13(6-9-16-12)14-7-8-15-13/h1-5,12H,6-10H2.
What are the key properties of 7-phenyl-1,4-dioxa-8-thiaspiro[4.5]decane?
7-phenyl-1,4-dioxa-8-thiaspiro[4.5]decane has a molecular weight of 236.34 g/mol, XLogP of 3.00, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-phenyl-1,4-dioxa-8-thiaspiro[4.5]decane is sourced from PubChem (CID 59332786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).