C31H41ClN2O4 — CID 59332999
[(1S,3R,4S)-3-amino-4-hydroxycyclopentyl]-[(2R)-2-[(1R)-1-[3-chloro-2-(3-ethylphenyl)phenyl]-1-hydroxyhept-6-enyl]morpholin-4-yl]methanone (PubChem CID 59332999) has the molecular formula C31H41ClN2O4 and a molecular weight of 541.13 g/mol. Its IUPAC name is [(1S,3R,4S)-3-amino-4-hydroxycyclopentyl]-[(2R)-2-[(1R)-1-[3-chloro-2-(3-ethylphenyl)phenyl]-1-hydroxyhept-6-enyl]morpholin-4-yl]methanone.
| Compound Name | [(1S,3R,4S)-3-amino-4-hydroxycyclopentyl]-[(2R)-2-[(1R)-1-[3-chloro-2-(3-ethylphenyl)phenyl]-1-hydroxyhept-6-enyl]morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 59332999 |
| Molecular Formula | C31H41ClN2O4 |
| Molecular Weight | 541.13 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | [(1S,3R,4S)-3-amino-4-hydroxycyclopentyl]-[(2R)-2-[(1R)-1-[3-chloro-2-(3-ethylphenyl)phenyl]-1-hydroxyhept-6-enyl]morpholin-4-yl]methanone |
| SMILES | C=CCCCC[C@@](O)(c1cccc(Cl)c1-c1cccc(CC)c1)[C@H]1CN(C(=O)[C@H]2C[C@@H](N)[C@@H](O)C2)CCO1 |
| InChI | InChI=1S/C31H41ClN2O4/c1-3-5-6-7-14-31(37,24-12-9-13-25(32)29(24)22-11-8-10-21(4-2)17-22)28-20-34(15-16-38-28)30(36)23-18-26(33)27(35)19-23/h3,8-13,17,23,26-28,35,37H,1,4-7,14-16,18-20,33H2,2H3/t23-,26+,27-,28+,31+/m0/s1 |
| InChIKey | DXPGVEVXTQLLQI-PIBIYZEDSA-N |
| XLogP | 4.83 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.13 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|