About 4-ethyl-2,2-dimethyl-7-propan-2-yl-1,4-benzoxazin-3-one
4-ethyl-2,2-dimethyl-7-propan-2-yl-1,4-benzoxazin-3-one (PubChem CID 59333179) has the molecular formula C15H21NO2
and a molecular weight of 247.34 g/mol. Its IUPAC name is 4-ethyl-2,2-dimethyl-7-propan-2-yl-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 4-ethyl-2,2-dimethyl-7-propan-2-yl-1,4-benzoxazin-3-one |
| PubChem CID | 59333179 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 4-ethyl-2,2-dimethyl-7-propan-2-yl-1,4-benzoxazin-3-one |
| SMILES | CCN1C(=O)C(C)(C)Oc2cc(C(C)C)ccc21 |
| InChI | InChI=1S/C15H21NO2/c1-6-16-12-8-7-11(10(2)3)9-13(12)18-15(4,5)14(16)17/h7-10H,6H2,1-5H3 |
| InChIKey | HIJVBYIKDFGUFP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-2,2-dimethyl-7-propan-2-yl-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2,2-dimethyl-7-propan-2-yl-1,4-benzoxazin-3-one?
The IUPAC name of 4-ethyl-2,2-dimethyl-7-propan-2-yl-1,4-benzoxazin-3-one (CID 59333179) is 4-ethyl-2,2-dimethyl-7-propan-2-yl-1,4-benzoxazin-3-one.
What is the SMILES notation for 4-ethyl-2,2-dimethyl-7-propan-2-yl-1,4-benzoxazin-3-one?
The canonical SMILES for 4-ethyl-2,2-dimethyl-7-propan-2-yl-1,4-benzoxazin-3-one is CCN1C(=O)C(C)(C)Oc2cc(C(C)C)ccc21.
What is the InChIKey of 4-ethyl-2,2-dimethyl-7-propan-2-yl-1,4-benzoxazin-3-one?
The InChIKey is HIJVBYIKDFGUFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2/c1-6-16-12-8-7-11(10(2)3)9-13(12)18-15(4,5)14(16)17/h7-10H,6H2,1-5H3.
What are the key properties of 4-ethyl-2,2-dimethyl-7-propan-2-yl-1,4-benzoxazin-3-one?
4-ethyl-2,2-dimethyl-7-propan-2-yl-1,4-benzoxazin-3-one has a molecular weight of 247.34 g/mol, XLogP of 3.33, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2,2-dimethyl-7-propan-2-yl-1,4-benzoxazin-3-one is sourced from PubChem (CID 59333179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).