C26H31F3N6O2 — CID 59333316
1-(5-tert-butyl-1H-pyrazol-3-yl)-N-[3-(oxan-2-yloxy)propyl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-amine (PubChem CID 59333316) has the molecular formula C26H31F3N6O2 and a molecular weight of 516.57 g/mol. Its IUPAC name is 1-(5-tert-butyl-1H-pyrazol-3-yl)-N-[3-(oxan-2-yloxy)propyl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-amine.
| Compound Name | 1-(5-tert-butyl-1H-pyrazol-3-yl)-N-[3-(oxan-2-yloxy)propyl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-amine |
|---|---|
| PubChem CID | 59333316 |
| Molecular Formula | C26H31F3N6O2 |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | 1-(5-tert-butyl-1H-pyrazol-3-yl)-N-[3-(oxan-2-yloxy)propyl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-amine |
| SMILES | CC(C)(C)c1cc(-c2cnc3c(NCCCOC4CCCCO4)nc4cc(C(F)(F)F)ccc4n23)n[nH]1 |
| InChI | InChI=1S/C26H31F3N6O2/c1-25(2,3)21-14-18(33-34-21)20-15-31-24-23(30-10-6-12-37-22-7-4-5-11-36-22)32-17-13-16(26(27,28)29)8-9-19(17)35(20)24/h8-9,13-15,22H,4-7,10-12H2,1-3H3,(H,30,32)(H,33,34) |
| InChIKey | UCQNRAKQJKTURQ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|