C26H29F3N4O3 — CID 59333324
4,4-dimethyl-1-[4-[3-(oxan-2-yloxy)propylamino]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-1-yl]pent-1-yn-3-one (PubChem CID 59333324) has the molecular formula C26H29F3N4O3 and a molecular weight of 502.54 g/mol. Its IUPAC name is 4,4-dimethyl-1-[4-[3-(oxan-2-yloxy)propylamino]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-1-yl]pent-1-yn-3-one.
| Compound Name | 4,4-dimethyl-1-[4-[3-(oxan-2-yloxy)propylamino]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-1-yl]pent-1-yn-3-one |
|---|---|
| PubChem CID | 59333324 |
| Molecular Formula | C26H29F3N4O3 |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 4,4-dimethyl-1-[4-[3-(oxan-2-yloxy)propylamino]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-1-yl]pent-1-yn-3-one |
| SMILES | CC(C)(C)C(=O)C#Cc1cnc2c(NCCCOC3CCCCO3)nc3cc(C(F)(F)F)ccc3n12 |
| InChI | InChI=1S/C26H29F3N4O3/c1-25(2,3)21(34)11-9-18-16-31-24-23(30-12-6-14-36-22-7-4-5-13-35-22)32-19-15-17(26(27,28)29)8-10-20(19)33(18)24/h8,10,15-16,22H,4-7,12-14H2,1-3H3,(H,30,32) |
| InChIKey | GQARCLTVLLDUOO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|