C19H20F3N5O — CID 59333345
3-[[1-(1,2,3,6-tetrahydropyridin-4-yl)-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propan-1-ol (PubChem CID 59333345) has the molecular formula C19H20F3N5O and a molecular weight of 391.40 g/mol. Its IUPAC name is 3-[[1-(1,2,3,6-tetrahydropyridin-4-yl)-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propan-1-ol.
| Compound Name | 3-[[1-(1,2,3,6-tetrahydropyridin-4-yl)-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 59333345 |
| Molecular Formula | C19H20F3N5O |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 3-[[1-(1,2,3,6-tetrahydropyridin-4-yl)-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propan-1-ol |
| SMILES | OCCCNc1nc2cc(C(F)(F)F)ccc2n2c(C3=CCNCC3)cnc12 |
| InChI | InChI=1S/C19H20F3N5O/c20-19(21,22)13-2-3-15-14(10-13)26-17(24-6-1-9-28)18-25-11-16(27(15)18)12-4-7-23-8-5-12/h2-4,10-11,23,28H,1,5-9H2,(H,24,26) |
| InChIKey | RMPSNPUSJIPWDN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|