C17H17FN4O3S — CID 59333830
4-[6-(6-fluoro-1H-indol-4-yl)-2-methylperoxysulfanylpyrimidin-4-yl]morpholine (PubChem CID 59333830) has the molecular formula C17H17FN4O3S and a molecular weight of 376.41 g/mol. Its IUPAC name is 4-[6-(6-fluoro-1H-indol-4-yl)-2-methylperoxysulfanylpyrimidin-4-yl]morpholine.
| Compound Name | 4-[6-(6-fluoro-1H-indol-4-yl)-2-methylperoxysulfanylpyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 59333830 |
| Molecular Formula | C17H17FN4O3S |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 4-[6-(6-fluoro-1H-indol-4-yl)-2-methylperoxysulfanylpyrimidin-4-yl]morpholine |
| SMILES | COOSc1nc(-c2cc(F)cc3[nH]ccc23)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C17H17FN4O3S/c1-23-25-26-17-20-15(10-16(21-17)22-4-6-24-7-5-22)13-8-11(18)9-14-12(13)2-3-19-14/h2-3,8-10,19H,4-7H2,1H3 |
| InChIKey | REXVQQUFZZBJFZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|