C14H17ClN6O2 — CID 59333961
3-[(4-ethoxypyrimidin-2-yl)amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carbonyl chloride (PubChem CID 59333961) has the molecular formula C14H17ClN6O2 and a molecular weight of 336.78 g/mol. Its IUPAC name is 3-[(4-ethoxypyrimidin-2-yl)amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carbonyl chloride.
| Compound Name | 3-[(4-ethoxypyrimidin-2-yl)amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carbonyl chloride |
|---|---|
| PubChem CID | 59333961 |
| Molecular Formula | C14H17ClN6O2 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 3-[(4-ethoxypyrimidin-2-yl)amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carbonyl chloride |
| SMILES | CCOc1ccnc(Nc2n[nH]c3c2CN(C(=O)Cl)C3(C)C)n1 |
| InChI | InChI=1S/C14H17ClN6O2/c1-4-23-9-5-6-16-13(17-9)18-11-8-7-21(12(15)22)14(2,3)10(8)19-20-11/h5-6H,4,7H2,1-3H3,(H2,16,17,18,19,20) |
| InChIKey | QBHHCYYZCSOUGB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|