C18H22ClN7O2 — CID 59334226
3,5-diamino-6-chloro-N-[5-[4-(4-hydroxyphenyl)butyl]-4,5-dihydro-1H-imidazol-2-yl]pyrazine-2-carboxamide (PubChem CID 59334226) has the molecular formula C18H22ClN7O2 and a molecular weight of 403.87 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[5-[4-(4-hydroxyphenyl)butyl]-4,5-dihydro-1H-imidazol-2-yl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[5-[4-(4-hydroxyphenyl)butyl]-4,5-dihydro-1H-imidazol-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 59334226 |
| Molecular Formula | C18H22ClN7O2 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[5-[4-(4-hydroxyphenyl)butyl]-4,5-dihydro-1H-imidazol-2-yl]pyrazine-2-carboxamide |
| SMILES | Nc1nc(N)c(C(=O)NC2=NCC(CCCCc3ccc(O)cc3)N2)nc1Cl |
| InChI | InChI=1S/C18H22ClN7O2/c19-14-16(21)25-15(20)13(24-14)17(28)26-18-22-9-11(23-18)4-2-1-3-10-5-7-12(27)8-6-10/h5-8,11,27H,1-4,9H2,(H4,20,21,25)(H2,22,23,26,28) |
| InChIKey | FONGSRVKLFAZCC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 151.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|