About 2-[(3-amino-4-fluorophenoxy)methyl]-3,4-difluorophenol
2-[(3-amino-4-fluorophenoxy)methyl]-3,4-difluorophenol (PubChem CID 59334372) has the molecular formula C13H10F3NO2
and a molecular weight of 269.22 g/mol. Its IUPAC name is 2-[(3-amino-4-fluorophenoxy)methyl]-3,4-difluorophenol.
Molecular Properties
| Compound Name | 2-[(3-amino-4-fluorophenoxy)methyl]-3,4-difluorophenol |
| PubChem CID | 59334372 |
| Molecular Formula | C13H10F3NO2 |
| Molecular Weight | 269.22 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2-[(3-amino-4-fluorophenoxy)methyl]-3,4-difluorophenol |
| SMILES | Nc1cc(OCc2c(O)ccc(F)c2F)ccc1F |
| InChI | InChI=1S/C13H10F3NO2/c14-9-2-1-7(5-11(9)17)19-6-8-12(18)4-3-10(15)13(8)16/h1-5,18H,6,17H2 |
| InChIKey | QFYVUMLCBNEHMU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.22 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-amino-4-fluorophenoxy)methyl]-3,4-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-amino-4-fluorophenoxy)methyl]-3,4-difluorophenol?
The IUPAC name of 2-[(3-amino-4-fluorophenoxy)methyl]-3,4-difluorophenol (CID 59334372) is 2-[(3-amino-4-fluorophenoxy)methyl]-3,4-difluorophenol.
What is the SMILES notation for 2-[(3-amino-4-fluorophenoxy)methyl]-3,4-difluorophenol?
The canonical SMILES for 2-[(3-amino-4-fluorophenoxy)methyl]-3,4-difluorophenol is Nc1cc(OCc2c(O)ccc(F)c2F)ccc1F.
What is the InChIKey of 2-[(3-amino-4-fluorophenoxy)methyl]-3,4-difluorophenol?
The InChIKey is QFYVUMLCBNEHMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F3NO2/c14-9-2-1-7(5-11(9)17)19-6-8-12(18)4-3-10(15)13(8)16/h1-5,18H,6,17H2.
What are the key properties of 2-[(3-amino-4-fluorophenoxy)methyl]-3,4-difluorophenol?
2-[(3-amino-4-fluorophenoxy)methyl]-3,4-difluorophenol has a molecular weight of 269.22 g/mol, XLogP of 2.97, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-amino-4-fluorophenoxy)methyl]-3,4-difluorophenol is sourced from PubChem (CID 59334372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).