About [2-(2-methylpyrazolo[1,5-a]pyridin-4-yl)cyclopropyl]methanamine
[2-(2-methylpyrazolo[1,5-a]pyridin-4-yl)cyclopropyl]methanamine (PubChem CID 59334610) has the molecular formula C12H15N3
and a molecular weight of 201.27 g/mol. Its IUPAC name is [2-(2-methylpyrazolo[1,5-a]pyridin-4-yl)cyclopropyl]methanamine.
Molecular Properties
| Compound Name | [2-(2-methylpyrazolo[1,5-a]pyridin-4-yl)cyclopropyl]methanamine |
| PubChem CID | 59334610 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | [2-(2-methylpyrazolo[1,5-a]pyridin-4-yl)cyclopropyl]methanamine |
| SMILES | Cc1cc2c(C3CC3CN)cccn2n1 |
| InChI | InChI=1S/C12H15N3/c1-8-5-12-10(11-6-9(11)7-13)3-2-4-15(12)14-8/h2-5,9,11H,6-7,13H2,1H3 |
| InChIKey | SDJHZZMAAAPMGT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(2-methylpyrazolo[1,5-a]pyridin-4-yl)cyclopropyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-methylpyrazolo[1,5-a]pyridin-4-yl)cyclopropyl]methanamine?
The IUPAC name of [2-(2-methylpyrazolo[1,5-a]pyridin-4-yl)cyclopropyl]methanamine (CID 59334610) is [2-(2-methylpyrazolo[1,5-a]pyridin-4-yl)cyclopropyl]methanamine.
What is the SMILES notation for [2-(2-methylpyrazolo[1,5-a]pyridin-4-yl)cyclopropyl]methanamine?
The canonical SMILES for [2-(2-methylpyrazolo[1,5-a]pyridin-4-yl)cyclopropyl]methanamine is Cc1cc2c(C3CC3CN)cccn2n1.
What is the InChIKey of [2-(2-methylpyrazolo[1,5-a]pyridin-4-yl)cyclopropyl]methanamine?
The InChIKey is SDJHZZMAAAPMGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3/c1-8-5-12-10(11-6-9(11)7-13)3-2-4-15(12)14-8/h2-5,9,11H,6-7,13H2,1H3.
What are the key properties of [2-(2-methylpyrazolo[1,5-a]pyridin-4-yl)cyclopropyl]methanamine?
[2-(2-methylpyrazolo[1,5-a]pyridin-4-yl)cyclopropyl]methanamine has a molecular weight of 201.27 g/mol, XLogP of 1.70, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-methylpyrazolo[1,5-a]pyridin-4-yl)cyclopropyl]methanamine is sourced from PubChem (CID 59334610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).