About 5-[(3,5-dichlorophenyl)sulfonylamino]-1-benzothiophene-3-carboxamide
5-[(3,5-dichlorophenyl)sulfonylamino]-1-benzothiophene-3-carboxamide (PubChem CID 59334919) has the molecular formula C15H10Cl2N2O3S2
and a molecular weight of 401.30 g/mol. Its IUPAC name is 5-[(3,5-dichlorophenyl)sulfonylamino]-1-benzothiophene-3-carboxamide.
Molecular Properties
| Compound Name | 5-[(3,5-dichlorophenyl)sulfonylamino]-1-benzothiophene-3-carboxamide |
| PubChem CID | 59334919 |
| Molecular Formula | C15H10Cl2N2O3S2 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 399.95 |
| IUPAC Name | 5-[(3,5-dichlorophenyl)sulfonylamino]-1-benzothiophene-3-carboxamide |
| SMILES | NC(=O)c1csc2ccc(NS(=O)(=O)c3cc(Cl)cc(Cl)c3)cc12 |
| InChI | InChI=1S/C15H10Cl2N2O3S2/c16-8-3-9(17)5-11(4-8)24(21,22)19-10-1-2-14-12(6-10)13(7-23-14)15(18)20/h1-7,19H,(H2,18,20) |
| InChIKey | OZZBPOMHSGZIDU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(3,5-dichlorophenyl)sulfonylamino]-1-benzothiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,5-dichlorophenyl)sulfonylamino]-1-benzothiophene-3-carboxamide?
The IUPAC name of 5-[(3,5-dichlorophenyl)sulfonylamino]-1-benzothiophene-3-carboxamide (CID 59334919) is 5-[(3,5-dichlorophenyl)sulfonylamino]-1-benzothiophene-3-carboxamide.
What is the SMILES notation for 5-[(3,5-dichlorophenyl)sulfonylamino]-1-benzothiophene-3-carboxamide?
The canonical SMILES for 5-[(3,5-dichlorophenyl)sulfonylamino]-1-benzothiophene-3-carboxamide is NC(=O)c1csc2ccc(NS(=O)(=O)c3cc(Cl)cc(Cl)c3)cc12.
What is the InChIKey of 5-[(3,5-dichlorophenyl)sulfonylamino]-1-benzothiophene-3-carboxamide?
The InChIKey is OZZBPOMHSGZIDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10Cl2N2O3S2/c16-8-3-9(17)5-11(4-8)24(21,22)19-10-1-2-14-12(6-10)13(7-23-14)15(18)20/h1-7,19H,(H2,18,20).
What are the key properties of 5-[(3,5-dichlorophenyl)sulfonylamino]-1-benzothiophene-3-carboxamide?
5-[(3,5-dichlorophenyl)sulfonylamino]-1-benzothiophene-3-carboxamide has a molecular weight of 401.30 g/mol, XLogP of 4.11, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-dichlorophenyl)sulfonylamino]-1-benzothiophene-3-carboxamide is sourced from PubChem (CID 59334919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).