About [1-[3-(2-ethoxyethylamino)-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite
[1-[3-(2-ethoxyethylamino)-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite (PubChem CID 59335515) has the molecular formula C11H17FN2O4S
and a molecular weight of 292.33 g/mol. Its IUPAC name is [1-[3-(2-ethoxyethylamino)-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite.
Molecular Properties
| Compound Name | [1-[3-(2-ethoxyethylamino)-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite |
| PubChem CID | 59335515 |
| Molecular Formula | C11H17FN2O4S |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | [1-[3-(2-ethoxyethylamino)-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite |
| SMILES | CCOCCNC(=O)CCN1C(=O)CC(SF)C1=O |
| InChI | InChI=1S/C11H17FN2O4S/c1-2-18-6-4-13-9(15)3-5-14-10(16)7-8(19-12)11(14)17/h8H,2-7H2,1H3,(H,13,15) |
| InChIKey | IWVPAAXKWSZTAD-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [1-[3-(2-ethoxyethylamino)-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[3-(2-ethoxyethylamino)-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite?
The IUPAC name of [1-[3-(2-ethoxyethylamino)-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite (CID 59335515) is [1-[3-(2-ethoxyethylamino)-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite.
What is the SMILES notation for [1-[3-(2-ethoxyethylamino)-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite?
The canonical SMILES for [1-[3-(2-ethoxyethylamino)-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite is CCOCCNC(=O)CCN1C(=O)CC(SF)C1=O.
What is the InChIKey of [1-[3-(2-ethoxyethylamino)-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite?
The InChIKey is IWVPAAXKWSZTAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17FN2O4S/c1-2-18-6-4-13-9(15)3-5-14-10(16)7-8(19-12)11(14)17/h8H,2-7H2,1H3,(H,13,15).
What are the key properties of [1-[3-(2-ethoxyethylamino)-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite?
[1-[3-(2-ethoxyethylamino)-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite has a molecular weight of 292.33 g/mol, XLogP of 0.27, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[3-(2-ethoxyethylamino)-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite is sourced from PubChem (CID 59335515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).