C34H49N9O13 — CID 59335550
ethyl N-[1-[[1,4-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-1,4-dioxobutan-2-yl]amino]-6-(ethoxycarbonylamino)-1-oxohexan-2-yl]carbamate (PubChem CID 59335550) has the molecular formula C34H49N9O13 and a molecular weight of 791.82 g/mol. Its IUPAC name is ethyl N-[1-[[1,4-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-1,4-dioxobutan-2-yl]amino]-6-(ethoxycarbonylamino)-1-oxohexan-2-yl]carbamate.
| Compound Name | ethyl N-[1-[[1,4-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-1,4-dioxobutan-2-yl]amino]-6-(ethoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 59335550 |
| Molecular Formula | C34H49N9O13 |
| Molecular Weight | 791.82 g/mol |
| Exact Mass | 791.34 |
| IUPAC Name | ethyl N-[1-[[1,4-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-1,4-dioxobutan-2-yl]amino]-6-(ethoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
| SMILES | CCOC(=O)NCCCCC(NC(=O)OCC)C(=O)NC(CC(=O)NCCNC(=O)CCN1C(=O)C=CC1=O)C(=O)NCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C34H49N9O13/c1-3-55-33(53)39-14-6-5-7-22(41-34(54)56-4-2)32(52)40-23(31(51)38-18-17-36-25(45)13-20-43-29(49)10-11-30(43)50)21-26(46)37-16-15-35-24(44)12-19-42-27(47)8-9-28(42)48/h8-11,22-23H,3-7,12-21H2,1-2H3,(H,35,44)(H,36,45)(H,37,46)(H,38,51)(H,39,53)(H,40,52)(H,41,54) |
| InChIKey | SQDYEPSXUZYIJZ-UHFFFAOYSA-N |
| XLogP | -3.01 |
| TPSA | 296.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.82 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|