C10H4F16O3 — CID 59335562
1,1,1,2,3,3-hexafluoro-3-[1,1,1,2,3,3-hexafluoro-3-(fluoromethoxy)propan-2-yl]oxy-2-(1,1,2-trifluoroprop-2-enoxy)propane (PubChem CID 59335562) has the molecular formula C10H4F16O3 and a molecular weight of 476.11 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-3-[1,1,1,2,3,3-hexafluoro-3-(fluoromethoxy)propan-2-yl]oxy-2-(1,1,2-trifluoroprop-2-enoxy)propane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-3-[1,1,1,2,3,3-hexafluoro-3-(fluoromethoxy)propan-2-yl]oxy-2-(1,1,2-trifluoroprop-2-enoxy)propane |
|---|---|
| PubChem CID | 59335562 |
| Molecular Formula | C10H4F16O3 |
| Molecular Weight | 476.11 g/mol |
| Exact Mass | 475.99 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-3-[1,1,1,2,3,3-hexafluoro-3-(fluoromethoxy)propan-2-yl]oxy-2-(1,1,2-trifluoroprop-2-enoxy)propane |
| SMILES | C=C(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OCF |
| InChI | InChI=1S/C10H4F16O3/c1-3(12)4(13,14)28-6(16,8(20,21)22)10(25,26)29-5(15,7(17,18)19)9(23,24)27-2-11/h1-2H2 |
| InChIKey | LHXNCBAZPYPDTA-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.11 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |