C7H4F10O2 — CID 59335563
1,1,1,2,3,3-hexafluoro-3-(fluoromethoxy)-2-(1,1,2-trifluoroprop-2-enoxy)propane (PubChem CID 59335563) has the molecular formula C7H4F10O2 and a molecular weight of 310.09 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-3-(fluoromethoxy)-2-(1,1,2-trifluoroprop-2-enoxy)propane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-3-(fluoromethoxy)-2-(1,1,2-trifluoroprop-2-enoxy)propane |
|---|---|
| PubChem CID | 59335563 |
| Molecular Formula | C7H4F10O2 |
| Molecular Weight | 310.09 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-3-(fluoromethoxy)-2-(1,1,2-trifluoroprop-2-enoxy)propane |
| SMILES | C=C(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OCF |
| InChI | InChI=1S/C7H4F10O2/c1-3(9)4(10,11)19-5(12,6(13,14)15)7(16,17)18-2-8/h1-2H2 |
| InChIKey | JOEJVBQMTDZVSD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.09 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |