About (5S)-5-[(1S,3S)-1-hydroxy-4-methyl-3-(phenylmethoxymethyl)pentyl]pyrrolidin-2-one
(5S)-5-[(1S,3S)-1-hydroxy-4-methyl-3-(phenylmethoxymethyl)pentyl]pyrrolidin-2-one (PubChem CID 59336239) has the molecular formula C18H27NO3
and a molecular weight of 305.42 g/mol. Its IUPAC name is (5S)-5-[(1S,3S)-1-hydroxy-4-methyl-3-(phenylmethoxymethyl)pentyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | (5S)-5-[(1S,3S)-1-hydroxy-4-methyl-3-(phenylmethoxymethyl)pentyl]pyrrolidin-2-one |
| PubChem CID | 59336239 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | (5S)-5-[(1S,3S)-1-hydroxy-4-methyl-3-(phenylmethoxymethyl)pentyl]pyrrolidin-2-one |
| SMILES | CC(C)[C@@H](COCc1ccccc1)C[C@H](O)[C@@H]1CCC(=O)N1 |
| InChI | InChI=1S/C18H27NO3/c1-13(2)15(10-17(20)16-8-9-18(21)19-16)12-22-11-14-6-4-3-5-7-14/h3-7,13,15-17,20H,8-12H2,1-2H3,(H,19,21)/t15-,16+,17+/m1/s1 |
| InChIKey | FUYZYQMHSRSXDK-IKGGRYGDSA-N |
| XLogP | 2.51 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S)-5-[(1S,3S)-1-hydroxy-4-methyl-3-(phenylmethoxymethyl)pentyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-[(1S,3S)-1-hydroxy-4-methyl-3-(phenylmethoxymethyl)pentyl]pyrrolidin-2-one?
The IUPAC name of (5S)-5-[(1S,3S)-1-hydroxy-4-methyl-3-(phenylmethoxymethyl)pentyl]pyrrolidin-2-one (CID 59336239) is (5S)-5-[(1S,3S)-1-hydroxy-4-methyl-3-(phenylmethoxymethyl)pentyl]pyrrolidin-2-one.
What is the SMILES notation for (5S)-5-[(1S,3S)-1-hydroxy-4-methyl-3-(phenylmethoxymethyl)pentyl]pyrrolidin-2-one?
The canonical SMILES for (5S)-5-[(1S,3S)-1-hydroxy-4-methyl-3-(phenylmethoxymethyl)pentyl]pyrrolidin-2-one is CC(C)[C@@H](COCc1ccccc1)C[C@H](O)[C@@H]1CCC(=O)N1.
What is the InChIKey of (5S)-5-[(1S,3S)-1-hydroxy-4-methyl-3-(phenylmethoxymethyl)pentyl]pyrrolidin-2-one?
The InChIKey is FUYZYQMHSRSXDK-IKGGRYGDSA-N. The full InChI is InChI=1S/C18H27NO3/c1-13(2)15(10-17(20)16-8-9-18(21)19-16)12-22-11-14-6-4-3-5-7-14/h3-7,13,15-17,20H,8-12H2,1-2H3,(H,19,21)/t15-,16+,17+/m1/s1.
What are the key properties of (5S)-5-[(1S,3S)-1-hydroxy-4-methyl-3-(phenylmethoxymethyl)pentyl]pyrrolidin-2-one?
(5S)-5-[(1S,3S)-1-hydroxy-4-methyl-3-(phenylmethoxymethyl)pentyl]pyrrolidin-2-one has a molecular weight of 305.42 g/mol, XLogP of 2.51, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-[(1S,3S)-1-hydroxy-4-methyl-3-(phenylmethoxymethyl)pentyl]pyrrolidin-2-one is sourced from PubChem (CID 59336239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).