About (5S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]pyrrolidin-2-one
(5S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]pyrrolidin-2-one (PubChem CID 59336255) has the molecular formula C12H19NO3
and a molecular weight of 225.29 g/mol. Its IUPAC name is (5S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | (5S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]pyrrolidin-2-one |
| PubChem CID | 59336255 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | (5S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]pyrrolidin-2-one |
| SMILES | CC(C)[C@@H]1C[C@@H]([C@@H]2CCC(=O)N2C)OC1=O |
| InChI | InChI=1S/C12H19NO3/c1-7(2)8-6-10(16-12(8)15)9-4-5-11(14)13(9)3/h7-10H,4-6H2,1-3H3/t8-,9-,10-/m0/s1 |
| InChIKey | QEVXAUPULDBGLN-GUBZILKMSA-N |
| XLogP | 1.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]pyrrolidin-2-one?
The IUPAC name of (5S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]pyrrolidin-2-one (CID 59336255) is (5S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]pyrrolidin-2-one.
What is the SMILES notation for (5S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]pyrrolidin-2-one?
The canonical SMILES for (5S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]pyrrolidin-2-one is CC(C)[C@@H]1C[C@@H]([C@@H]2CCC(=O)N2C)OC1=O.
What is the InChIKey of (5S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]pyrrolidin-2-one?
The InChIKey is QEVXAUPULDBGLN-GUBZILKMSA-N. The full InChI is InChI=1S/C12H19NO3/c1-7(2)8-6-10(16-12(8)15)9-4-5-11(14)13(9)3/h7-10H,4-6H2,1-3H3/t8-,9-,10-/m0/s1.
What are the key properties of (5S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]pyrrolidin-2-one?
(5S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]pyrrolidin-2-one has a molecular weight of 225.29 g/mol, XLogP of 1.19, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]pyrrolidin-2-one is sourced from PubChem (CID 59336255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).