C9H7F4NO2 — CID 59336367
(NZ)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylidene]hydroxylamine (PubChem CID 59336367) has the molecular formula C9H7F4NO2 and a molecular weight of 237.15 g/mol. Its IUPAC name is (NZ)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 59336367 |
| Molecular Formula | C9H7F4NO2 |
| Molecular Weight | 237.15 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | (NZ)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylidene]hydroxylamine |
| SMILES | O/N=C\c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C9H7F4NO2/c10-8(11)9(12,13)16-7-3-1-2-6(4-7)5-14-15/h1-5,8,15H/b14-5- |
| InChIKey | FWVKVGBZHTVWFR-RZNTYIFUSA-N |
| XLogP | 2.73 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.15 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|