C20H25ClO2 — CID 59336854
2-[2-[(2-chlorophenyl)methyl]-5-methyl-2-adamantyl]acetic acid (PubChem CID 59336854) has the molecular formula C20H25ClO2 and a molecular weight of 332.87 g/mol. Its IUPAC name is 2-[2-[(2-chlorophenyl)methyl]-5-methyl-2-adamantyl]acetic acid.
| Compound Name | 2-[2-[(2-chlorophenyl)methyl]-5-methyl-2-adamantyl]acetic acid |
|---|---|
| PubChem CID | 59336854 |
| Molecular Formula | C20H25ClO2 |
| Molecular Weight | 332.87 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 2-[2-[(2-chlorophenyl)methyl]-5-methyl-2-adamantyl]acetic acid |
| SMILES | CC12CC3CC(C1)C(CC(=O)O)(Cc1ccccc1Cl)C(C3)C2 |
| InChI | InChI=1S/C20H25ClO2/c1-19-8-13-6-15(10-19)20(12-18(22)23,16(7-13)11-19)9-14-4-2-3-5-17(14)21/h2-5,13,15-16H,6-12H2,1H3,(H,22,23) |
| InChIKey | YWJGJHYLJHEECT-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.87 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |