C23H31NO3 — CID 59337101
2-(6-hydroxy-2-phenyl-2-adamantyl)-1-[(3R)-3-hydroxypiperidin-1-yl]ethanone (PubChem CID 59337101) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is 2-(6-hydroxy-2-phenyl-2-adamantyl)-1-[(3R)-3-hydroxypiperidin-1-yl]ethanone.
| Compound Name | 2-(6-hydroxy-2-phenyl-2-adamantyl)-1-[(3R)-3-hydroxypiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 59337101 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 2-(6-hydroxy-2-phenyl-2-adamantyl)-1-[(3R)-3-hydroxypiperidin-1-yl]ethanone |
| SMILES | O=C(CC1(c2ccccc2)C2CC3CC1CC(C2)C3O)N1CCC[C@@H](O)C1 |
| InChI | InChI=1S/C23H31NO3/c25-20-7-4-8-24(14-20)21(26)13-23(17-5-2-1-3-6-17)18-9-15-10-19(23)12-16(11-18)22(15)27/h1-3,5-6,15-16,18-20,22,25,27H,4,7-14H2/t15?,16?,18?,19?,20-,22?,23?/m1/s1 |
| InChIKey | GSOMNFHYOZUZFU-ANQJAKNGSA-N |
| XLogP | 2.72 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |