C24H33N3 — CID 59337692
2-[1'-(2,2-dimethylpropyl)spiro[2,3-dihydroquinoline-4,4'-piperidine]-1-yl]aniline (PubChem CID 59337692) has the molecular formula C24H33N3 and a molecular weight of 363.55 g/mol. Its IUPAC name is 2-[1'-(2,2-dimethylpropyl)spiro[2,3-dihydroquinoline-4,4'-piperidine]-1-yl]aniline.
| Compound Name | 2-[1'-(2,2-dimethylpropyl)spiro[2,3-dihydroquinoline-4,4'-piperidine]-1-yl]aniline |
|---|---|
| PubChem CID | 59337692 |
| Molecular Formula | C24H33N3 |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.27 |
| IUPAC Name | 2-[1'-(2,2-dimethylpropyl)spiro[2,3-dihydroquinoline-4,4'-piperidine]-1-yl]aniline |
| SMILES | CC(C)(C)CN1CCC2(CC1)CCN(c1ccccc1N)c1ccccc12 |
| InChI | InChI=1S/C24H33N3/c1-23(2,3)18-26-15-12-24(13-16-26)14-17-27(21-10-6-4-8-19(21)24)22-11-7-5-9-20(22)25/h4-11H,12-18,25H2,1-3H3 |
| InChIKey | ZJMAVUDDTPJVLT-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|