About (4-butyl-1,4-diazepan-1-yl)-[2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]methanone
(4-butyl-1,4-diazepan-1-yl)-[2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]methanone (PubChem CID 59337995) has the molecular formula C20H26FN3OS
and a molecular weight of 375.51 g/mol. Its IUPAC name is (4-butyl-1,4-diazepan-1-yl)-[2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]methanone.
Molecular Properties
| Compound Name | (4-butyl-1,4-diazepan-1-yl)-[2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]methanone |
| PubChem CID | 59337995 |
| Molecular Formula | C20H26FN3OS |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (4-butyl-1,4-diazepan-1-yl)-[2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]methanone |
| SMILES | CCCCN1CCCN(C(=O)c2sc(-c3ccccc3F)nc2C)CC1 |
| InChI | InChI=1S/C20H26FN3OS/c1-3-4-10-23-11-7-12-24(14-13-23)20(25)18-15(2)22-19(26-18)16-8-5-6-9-17(16)21/h5-6,8-9H,3-4,7,10-14H2,1-2H3 |
| InChIKey | FQXMXVBQLRGFLF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-butyl-1,4-diazepan-1-yl)-[2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-butyl-1,4-diazepan-1-yl)-[2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]methanone?
The IUPAC name of (4-butyl-1,4-diazepan-1-yl)-[2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]methanone (CID 59337995) is (4-butyl-1,4-diazepan-1-yl)-[2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]methanone.
What is the SMILES notation for (4-butyl-1,4-diazepan-1-yl)-[2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]methanone?
The canonical SMILES for (4-butyl-1,4-diazepan-1-yl)-[2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]methanone is CCCCN1CCCN(C(=O)c2sc(-c3ccccc3F)nc2C)CC1.
What is the InChIKey of (4-butyl-1,4-diazepan-1-yl)-[2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]methanone?
The InChIKey is FQXMXVBQLRGFLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26FN3OS/c1-3-4-10-23-11-7-12-24(14-13-23)20(25)18-15(2)22-19(26-18)16-8-5-6-9-17(16)21/h5-6,8-9H,3-4,7,10-14H2,1-2H3.
What are the key properties of (4-butyl-1,4-diazepan-1-yl)-[2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]methanone?
(4-butyl-1,4-diazepan-1-yl)-[2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]methanone has a molecular weight of 375.51 g/mol, XLogP of 4.21, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-butyl-1,4-diazepan-1-yl)-[2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]methanone is sourced from PubChem (CID 59337995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).