C18H13ClN6O2 — CID 59339250
N-(3-chlorophenyl)-3-[(4-nitrophenyl)methyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 59339250) has the molecular formula C18H13ClN6O2 and a molecular weight of 380.80 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-[(4-nitrophenyl)methyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-(3-chlorophenyl)-3-[(4-nitrophenyl)methyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 59339250 |
| Molecular Formula | C18H13ClN6O2 |
| Molecular Weight | 380.80 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | N-(3-chlorophenyl)-3-[(4-nitrophenyl)methyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | O=[N+]([O-])c1ccc(Cc2nnc3ccc(Nc4cccc(Cl)c4)nn23)cc1 |
| InChI | InChI=1S/C18H13ClN6O2/c19-13-2-1-3-14(11-13)20-16-8-9-17-21-22-18(24(17)23-16)10-12-4-6-15(7-5-12)25(26)27/h1-9,11H,10H2,(H,20,23) |
| InChIKey | QZJIGNPBTDEEKU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.80 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|