C11H13ClN6O2S2 — CID 59339305
N'-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-4-ethyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 59339305) has the molecular formula C11H13ClN6O2S2 and a molecular weight of 360.85 g/mol. Its IUPAC name is N'-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-4-ethyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | N'-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-4-ethyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 59339305 |
| Molecular Formula | C11H13ClN6O2S2 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | N'-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-4-ethyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | CCC1C=NN(/C(N)=N/S(=O)(=O)c2c(Cl)nc3sccn23)C1 |
| InChI | InChI=1S/C11H13ClN6O2S2/c1-2-7-5-14-18(6-7)10(13)16-22(19,20)9-8(12)15-11-17(9)3-4-21-11/h3-5,7H,2,6H2,1H3,(H2,13,16) |
| InChIKey | GKBPDFJNLGAPMV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|