C16H18F6N4O2S — CID 59339318
N-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-N',4-diethyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 59339318) has the molecular formula C16H18F6N4O2S and a molecular weight of 444.40 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-N',4-diethyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-N',4-diethyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 59339318 |
| Molecular Formula | C16H18F6N4O2S |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-N',4-diethyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | CC/N=C(/NS(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CC(CC)C=N1 |
| InChI | InChI=1S/C16H18F6N4O2S/c1-3-10-8-24-26(9-10)14(23-4-2)25-29(27,28)13-6-11(15(17,18)19)5-12(7-13)16(20,21)22/h5-8,10H,3-4,9H2,1-2H3,(H,23,25) |
| InChIKey | DMBYCXRERYFOOF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|