C12H15ClN6O2S2 — CID 59339336
N-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-N',4,4-trimethyl-3H-pyrazole-2-carboximidamide (PubChem CID 59339336) has the molecular formula C12H15ClN6O2S2 and a molecular weight of 374.88 g/mol. Its IUPAC name is N-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-N',4,4-trimethyl-3H-pyrazole-2-carboximidamide.
| Compound Name | N-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-N',4,4-trimethyl-3H-pyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 59339336 |
| Molecular Formula | C12H15ClN6O2S2 |
| Molecular Weight | 374.88 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | N-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-N',4,4-trimethyl-3H-pyrazole-2-carboximidamide |
| SMILES | C/N=C(/NS(=O)(=O)c1c(Cl)nc2sccn12)N1CC(C)(C)C=N1 |
| InChI | InChI=1S/C12H15ClN6O2S2/c1-12(2)6-15-19(7-12)10(14-3)17-23(20,21)9-8(13)16-11-18(9)4-5-22-11/h4-6H,7H2,1-3H3,(H,14,17) |
| InChIKey | GXJDALPIAZISQA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 91.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.88 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|