C17H27N5O4S — CID 59339340
ethyl 4-[[N-ethyl-C-(4-ethyl-3,4-dihydropyrazol-2-yl)carbonimidoyl]sulfamoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 59339340) has the molecular formula C17H27N5O4S and a molecular weight of 397.50 g/mol. Its IUPAC name is ethyl 4-[[N-ethyl-C-(4-ethyl-3,4-dihydropyrazol-2-yl)carbonimidoyl]sulfamoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-[[N-ethyl-C-(4-ethyl-3,4-dihydropyrazol-2-yl)carbonimidoyl]sulfamoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 59339340 |
| Molecular Formula | C17H27N5O4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | ethyl 4-[[N-ethyl-C-(4-ethyl-3,4-dihydropyrazol-2-yl)carbonimidoyl]sulfamoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CC/N=C(/NS(=O)(=O)c1c(C)[nH]c(C(=O)OCC)c1C)N1CC(CC)C=N1 |
| InChI | InChI=1S/C17H27N5O4S/c1-6-13-9-19-22(10-13)17(18-7-2)21-27(24,25)15-11(4)14(20-12(15)5)16(23)26-8-3/h9,13,20H,6-8,10H2,1-5H3,(H,18,21) |
| InChIKey | LYUVNQGXCIPBSI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 116.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|