About 5-(furan-3-yl)-4,5-dihydro-1H-pyrazole
5-(furan-3-yl)-4,5-dihydro-1H-pyrazole (PubChem CID 59339389) has the molecular formula C7H8N2O
and a molecular weight of 136.15 g/mol. Its IUPAC name is 5-(furan-3-yl)-4,5-dihydro-1H-pyrazole.
Molecular Properties
| Compound Name | 5-(furan-3-yl)-4,5-dihydro-1H-pyrazole |
| PubChem CID | 59339389 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | 5-(furan-3-yl)-4,5-dihydro-1H-pyrazole |
| SMILES | C1=NNC(c2ccoc2)C1 |
| InChI | InChI=1S/C7H8N2O/c1-3-8-9-7(1)6-2-4-10-5-6/h2-5,7,9H,1H2 |
| InChIKey | PHAMBRRBNHMIAL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(furan-3-yl)-4,5-dihydro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(furan-3-yl)-4,5-dihydro-1H-pyrazole?
The IUPAC name of 5-(furan-3-yl)-4,5-dihydro-1H-pyrazole (CID 59339389) is 5-(furan-3-yl)-4,5-dihydro-1H-pyrazole.
What is the SMILES notation for 5-(furan-3-yl)-4,5-dihydro-1H-pyrazole?
The canonical SMILES for 5-(furan-3-yl)-4,5-dihydro-1H-pyrazole is C1=NNC(c2ccoc2)C1.
What is the InChIKey of 5-(furan-3-yl)-4,5-dihydro-1H-pyrazole?
The InChIKey is PHAMBRRBNHMIAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O/c1-3-8-9-7(1)6-2-4-10-5-6/h2-5,7,9H,1H2.
What are the key properties of 5-(furan-3-yl)-4,5-dihydro-1H-pyrazole?
5-(furan-3-yl)-4,5-dihydro-1H-pyrazole has a molecular weight of 136.15 g/mol, XLogP of 1.30, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(furan-3-yl)-4,5-dihydro-1H-pyrazole is sourced from PubChem (CID 59339389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).