C13H17ClN6O2S2 — CID 59339433
N-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-N'-ethyl-4,4-dimethyl-3H-pyrazole-2-carboximidamide (PubChem CID 59339433) has the molecular formula C13H17ClN6O2S2 and a molecular weight of 388.91 g/mol. Its IUPAC name is N-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-N'-ethyl-4,4-dimethyl-3H-pyrazole-2-carboximidamide.
| Compound Name | N-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-N'-ethyl-4,4-dimethyl-3H-pyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 59339433 |
| Molecular Formula | C13H17ClN6O2S2 |
| Molecular Weight | 388.91 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | N-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-N'-ethyl-4,4-dimethyl-3H-pyrazole-2-carboximidamide |
| SMILES | CC/N=C(/NS(=O)(=O)c1c(Cl)nc2sccn12)N1CC(C)(C)C=N1 |
| InChI | InChI=1S/C13H17ClN6O2S2/c1-4-15-11(20-8-13(2,3)7-16-20)18-24(21,22)10-9(14)17-12-19(10)5-6-23-12/h5-7H,4,8H2,1-3H3,(H,15,18) |
| InChIKey | KJJMBUQOBMTMTQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 91.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.91 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|