C9H16F6N2 — CID 59339468
2,2-bis(3,3,3-trifluoropropyl)propane-1,3-diamine (PubChem CID 59339468) has the molecular formula C9H16F6N2 and a molecular weight of 266.23 g/mol. Its IUPAC name is 2,2-bis(3,3,3-trifluoropropyl)propane-1,3-diamine.
| Compound Name | 2,2-bis(3,3,3-trifluoropropyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 59339468 |
| Molecular Formula | C9H16F6N2 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2,2-bis(3,3,3-trifluoropropyl)propane-1,3-diamine |
| SMILES | NCC(CN)(CCC(F)(F)F)CCC(F)(F)F |
| InChI | InChI=1S/C9H16F6N2/c10-8(11,12)3-1-7(5-16,6-17)2-4-9(13,14)15/h1-6,16-17H2 |
| InChIKey | KQTLXFMEIMEVQT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |