About 2-chloro-1,5-difluoro-3-(4-methoxybutoxy)benzene
2-chloro-1,5-difluoro-3-(4-methoxybutoxy)benzene (PubChem CID 59339533) has the molecular formula C11H13ClF2O2
and a molecular weight of 250.67 g/mol. Its IUPAC name is 2-chloro-1,5-difluoro-3-(4-methoxybutoxy)benzene.
Molecular Properties
| Compound Name | 2-chloro-1,5-difluoro-3-(4-methoxybutoxy)benzene |
| PubChem CID | 59339533 |
| Molecular Formula | C11H13ClF2O2 |
| Molecular Weight | 250.67 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2-chloro-1,5-difluoro-3-(4-methoxybutoxy)benzene |
| SMILES | COCCCCOc1cc(F)cc(F)c1Cl |
| InChI | InChI=1S/C11H13ClF2O2/c1-15-4-2-3-5-16-10-7-8(13)6-9(14)11(10)12/h6-7H,2-5H2,1H3 |
| InChIKey | VTZLXZWBXXYDRG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.67 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1,5-difluoro-3-(4-methoxybutoxy)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,5-difluoro-3-(4-methoxybutoxy)benzene?
The IUPAC name of 2-chloro-1,5-difluoro-3-(4-methoxybutoxy)benzene (CID 59339533) is 2-chloro-1,5-difluoro-3-(4-methoxybutoxy)benzene.
What is the SMILES notation for 2-chloro-1,5-difluoro-3-(4-methoxybutoxy)benzene?
The canonical SMILES for 2-chloro-1,5-difluoro-3-(4-methoxybutoxy)benzene is COCCCCOc1cc(F)cc(F)c1Cl.
What is the InChIKey of 2-chloro-1,5-difluoro-3-(4-methoxybutoxy)benzene?
The InChIKey is VTZLXZWBXXYDRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClF2O2/c1-15-4-2-3-5-16-10-7-8(13)6-9(14)11(10)12/h6-7H,2-5H2,1H3.
What are the key properties of 2-chloro-1,5-difluoro-3-(4-methoxybutoxy)benzene?
2-chloro-1,5-difluoro-3-(4-methoxybutoxy)benzene has a molecular weight of 250.67 g/mol, XLogP of 3.42, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,5-difluoro-3-(4-methoxybutoxy)benzene is sourced from PubChem (CID 59339533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).