C22H15F4N3O2 — CID 59339720
N-[1,1,1-trifluoro-3-[1-(4-fluorophenyl)indazol-5-yl]oxy-3-phenylpropan-2-ylidene]hydroxylamine (PubChem CID 59339720) has the molecular formula C22H15F4N3O2 and a molecular weight of 429.37 g/mol. Its IUPAC name is N-[1,1,1-trifluoro-3-[1-(4-fluorophenyl)indazol-5-yl]oxy-3-phenylpropan-2-ylidene]hydroxylamine.
| Compound Name | N-[1,1,1-trifluoro-3-[1-(4-fluorophenyl)indazol-5-yl]oxy-3-phenylpropan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 59339720 |
| Molecular Formula | C22H15F4N3O2 |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | N-[1,1,1-trifluoro-3-[1-(4-fluorophenyl)indazol-5-yl]oxy-3-phenylpropan-2-ylidene]hydroxylamine |
| SMILES | ON=C(C(Oc1ccc2c(cnn2-c2ccc(F)cc2)c1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C22H15F4N3O2/c23-16-6-8-17(9-7-16)29-19-11-10-18(12-15(19)13-27-29)31-20(14-4-2-1-3-5-14)21(28-30)22(24,25)26/h1-13,20,30H |
| InChIKey | FDAKYTNDEYAXPF-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|