C7H9N2Rb — CID 59339956
3-ethenyl-2,5-dimethyl-4H-imidazol-4-ide;rubidium(1+) (PubChem CID 59339956) has the molecular formula C7H9N2Rb and a molecular weight of 206.63 g/mol. Its IUPAC name is 3-ethenyl-2,5-dimethyl-4H-imidazol-4-ide;rubidium(1+).
| Compound Name | 3-ethenyl-2,5-dimethyl-4H-imidazol-4-ide;rubidium(1+) |
|---|---|
| PubChem CID | 59339956 |
| Molecular Formula | C7H9N2Rb |
| Molecular Weight | 206.63 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | 3-ethenyl-2,5-dimethyl-4H-imidazol-4-ide;rubidium(1+) |
| SMILES | C=Cn1[c-]c(C)nc1C.[Rb+] |
| InChI | InChI=1S/C7H9N2.Rb/c1-4-9-5-6(2)8-7(9)3;/h4H,1H2,2-3H3;/q-1;+1 |
| InChIKey | KAHZBCCKOITRBH-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.63 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|