C19H30N3O3W- — CID 59340365
(2S)-N-[(1R)-1-acetyl-2-ethenylcyclopropyl]-1-[(2S)-3,3-dimethyl-2-(methylamino)butanoyl]pyrrolidin-4-ide-2-carboxamide;tungsten (PubChem CID 59340365) has the molecular formula C19H30N3O3W- and a molecular weight of 532.31 g/mol. Its IUPAC name is (2S)-N-[(1R)-1-acetyl-2-ethenylcyclopropyl]-1-[(2S)-3,3-dimethyl-2-(methylamino)butanoyl]pyrrolidin-4-ide-2-carboxamide;tungsten.
| Compound Name | (2S)-N-[(1R)-1-acetyl-2-ethenylcyclopropyl]-1-[(2S)-3,3-dimethyl-2-(methylamino)butanoyl]pyrrolidin-4-ide-2-carboxamide;tungsten |
|---|---|
| PubChem CID | 59340365 |
| Molecular Formula | C19H30N3O3W- |
| Molecular Weight | 532.31 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | (2S)-N-[(1R)-1-acetyl-2-ethenylcyclopropyl]-1-[(2S)-3,3-dimethyl-2-(methylamino)butanoyl]pyrrolidin-4-ide-2-carboxamide;tungsten |
| SMILES | C=CC1C[C@]1(NC(=O)[C@@H]1C[CH-]CN1C(=O)[C@@H](NC)C(C)(C)C)C(C)=O.[W] |
| InChI | InChI=1S/C19H30N3O3.W/c1-7-13-11-19(13,12(2)23)21-16(24)14-9-8-10-22(14)17(25)15(20-6)18(3,4)5;/h7-8,13-15,20H,1,9-11H2,2-6H3,(H,21,24);/q-1;/t13?,14-,15+,19-;/m0./s1 |
| InChIKey | WZIGLHINRONLGH-OACROKLFSA-N |
| XLogP | 1.07 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|