About CID 59340592
CID 59340592 (PubChem CID 59340592) has the molecular formula C14H22
and a molecular weight of 190.33 g/mol.
Molecular Properties
| Compound Name | CID 59340592 |
| PubChem CID | 59340592 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | — |
| SMILES | [CH]CCC(C)(C)C#CC(C)(C)CC[CH] |
| InChI | InChI=1S/C14H22/c1-7-9-13(3,4)11-12-14(5,6)10-8-2/h1-2H,7-10H2,3-6H3 |
| InChIKey | LWAVYHVJMGPSMT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 59340592 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59340592?
The IUPAC name of CID 59340592 (CID 59340592) is not available.
What is the SMILES notation for CID 59340592?
The canonical SMILES for CID 59340592 is [CH]CCC(C)(C)C#CC(C)(C)CC[CH].
What is the InChIKey of CID 59340592?
The InChIKey is LWAVYHVJMGPSMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22/c1-7-9-13(3,4)11-12-14(5,6)10-8-2/h1-2H,7-10H2,3-6H3.
What are the key properties of CID 59340592?
CID 59340592 has a molecular weight of 190.33 g/mol, XLogP of 4.02, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59340592 is sourced from PubChem (CID 59340592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).