C29H32N4 — CID 59340678
N'-[6-(4-methylphenyl)-2,5-diphenylpyrimidin-4-yl]hexane-1,6-diamine (PubChem CID 59340678) has the molecular formula C29H32N4 and a molecular weight of 436.60 g/mol. Its IUPAC name is N'-[6-(4-methylphenyl)-2,5-diphenylpyrimidin-4-yl]hexane-1,6-diamine.
| Compound Name | N'-[6-(4-methylphenyl)-2,5-diphenylpyrimidin-4-yl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 59340678 |
| Molecular Formula | C29H32N4 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | N'-[6-(4-methylphenyl)-2,5-diphenylpyrimidin-4-yl]hexane-1,6-diamine |
| SMILES | Cc1ccc(-c2nc(-c3ccccc3)nc(NCCCCCCN)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H32N4/c1-22-16-18-24(19-17-22)27-26(23-12-6-4-7-13-23)29(31-21-11-3-2-10-20-30)33-28(32-27)25-14-8-5-9-15-25/h4-9,12-19H,2-3,10-11,20-21,30H2,1H3,(H,31,32,33) |
| InChIKey | AKFLNUSHZPUMNJ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|