C11H10F4 — CID 59340809
3,3,4,5-tetrafluoro-2,6-dimethyl-1,2-dihydroindene (PubChem CID 59340809) has the molecular formula C11H10F4 and a molecular weight of 218.19 g/mol. Its IUPAC name is 3,3,4,5-tetrafluoro-2,6-dimethyl-1,2-dihydroindene.
| Compound Name | 3,3,4,5-tetrafluoro-2,6-dimethyl-1,2-dihydroindene |
|---|---|
| PubChem CID | 59340809 |
| Molecular Formula | C11H10F4 |
| Molecular Weight | 218.19 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 3,3,4,5-tetrafluoro-2,6-dimethyl-1,2-dihydroindene |
| SMILES | Cc1cc2c(c(F)c1F)C(F)(F)C(C)C2 |
| InChI | InChI=1S/C11H10F4/c1-5-3-7-4-6(2)11(14,15)8(7)10(13)9(5)12/h3,6H,4H2,1-2H3 |
| InChIKey | KWIBVFGGJBYGJA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.19 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |