About 5-(1-fluoroethyl)-1,4-dimethylpyrazole
5-(1-fluoroethyl)-1,4-dimethylpyrazole (PubChem CID 59340902) has the molecular formula C7H11FN2
and a molecular weight of 142.18 g/mol. Its IUPAC name is 5-(1-fluoroethyl)-1,4-dimethylpyrazole.
Molecular Properties
| Compound Name | 5-(1-fluoroethyl)-1,4-dimethylpyrazole |
| PubChem CID | 59340902 |
| Molecular Formula | C7H11FN2 |
| Molecular Weight | 142.18 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | 5-(1-fluoroethyl)-1,4-dimethylpyrazole |
| SMILES | Cc1cnn(C)c1C(C)F |
| InChI | InChI=1S/C7H11FN2/c1-5-4-9-10(3)7(5)6(2)8/h4,6H,1-3H3 |
| InChIKey | BNOBQBYNJYZTIY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.18 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(1-fluoroethyl)-1,4-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-fluoroethyl)-1,4-dimethylpyrazole?
The IUPAC name of 5-(1-fluoroethyl)-1,4-dimethylpyrazole (CID 59340902) is 5-(1-fluoroethyl)-1,4-dimethylpyrazole.
What is the SMILES notation for 5-(1-fluoroethyl)-1,4-dimethylpyrazole?
The canonical SMILES for 5-(1-fluoroethyl)-1,4-dimethylpyrazole is Cc1cnn(C)c1C(C)F.
What is the InChIKey of 5-(1-fluoroethyl)-1,4-dimethylpyrazole?
The InChIKey is BNOBQBYNJYZTIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11FN2/c1-5-4-9-10(3)7(5)6(2)8/h4,6H,1-3H3.
What are the key properties of 5-(1-fluoroethyl)-1,4-dimethylpyrazole?
5-(1-fluoroethyl)-1,4-dimethylpyrazole has a molecular weight of 142.18 g/mol, XLogP of 1.76, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-fluoroethyl)-1,4-dimethylpyrazole is sourced from PubChem (CID 59340902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).