C9H14OS6 — CID 59341508
S-[[8-(sulfanylmethyl)-1,4,6,9-tetrathiaspiro[4.4]nonan-3-yl]methyl] ethanethioate (PubChem CID 59341508) has the molecular formula C9H14OS6 and a molecular weight of 330.61 g/mol. Its IUPAC name is S-[[8-(sulfanylmethyl)-1,4,6,9-tetrathiaspiro[4.4]nonan-3-yl]methyl] ethanethioate.
| Compound Name | S-[[8-(sulfanylmethyl)-1,4,6,9-tetrathiaspiro[4.4]nonan-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 59341508 |
| Molecular Formula | C9H14OS6 |
| Molecular Weight | 330.61 g/mol |
| Exact Mass | 329.94 |
| IUPAC Name | S-[[8-(sulfanylmethyl)-1,4,6,9-tetrathiaspiro[4.4]nonan-3-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1CSC2(SCC(CS)S2)S1 |
| InChI | InChI=1S/C9H14OS6/c1-6(10)12-3-8-5-14-9(16-8)13-4-7(2-11)15-9/h7-8,11H,2-5H2,1H3 |
| InChIKey | ZZDMQELJBQTUDJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.61 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|