C7H12S6 — CID 59341509
[3-(sulfanylmethyl)-1,4,6,9-tetrathiaspiro[4.4]nonan-8-yl]methanethiol (PubChem CID 59341509) has the molecular formula C7H12S6 and a molecular weight of 288.58 g/mol. Its IUPAC name is [3-(sulfanylmethyl)-1,4,6,9-tetrathiaspiro[4.4]nonan-8-yl]methanethiol.
| Compound Name | [3-(sulfanylmethyl)-1,4,6,9-tetrathiaspiro[4.4]nonan-8-yl]methanethiol |
|---|---|
| PubChem CID | 59341509 |
| Molecular Formula | C7H12S6 |
| Molecular Weight | 288.58 g/mol |
| Exact Mass | 287.93 |
| IUPAC Name | [3-(sulfanylmethyl)-1,4,6,9-tetrathiaspiro[4.4]nonan-8-yl]methanethiol |
| SMILES | SCC1CSC2(SCC(CS)S2)S1 |
| InChI | InChI=1S/C7H12S6/c8-1-5-3-10-7(12-5)11-4-6(2-9)13-7/h5-6,8-9H,1-4H2 |
| InChIKey | ZJIAAUGHLJCVSE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.58 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|