C42H12F18O2S2 — CID 59341623
1-[2,5-diphenyl-4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)sulfanylphenoxy]phenoxy]-2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)sulfanylbenzene (PubChem CID 59341623) has the molecular formula C42H12F18O2S2 and a molecular weight of 954.65 g/mol. Its IUPAC name is 1-[2,5-diphenyl-4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)sulfanylphenoxy]phenoxy]-2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)sulfanylbenzene.
| Compound Name | 1-[2,5-diphenyl-4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)sulfanylphenoxy]phenoxy]-2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)sulfanylbenzene |
|---|---|
| PubChem CID | 59341623 |
| Molecular Formula | C42H12F18O2S2 |
| Molecular Weight | 954.65 g/mol |
| Exact Mass | 954.00 |
| IUPAC Name | 1-[2,5-diphenyl-4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)sulfanylphenoxy]phenoxy]-2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)sulfanylbenzene |
| SMILES | Fc1c(F)c(F)c(Sc2c(F)c(F)c(Oc3cc(-c4ccccc4)c(Oc4c(F)c(F)c(Sc5c(F)c(F)c(F)c(F)c5F)c(F)c4F)cc3-c3ccccc3)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C42H12F18O2S2/c43-19-21(45)29(53)39(30(54)22(19)46)63-41-33(57)25(49)37(26(50)34(41)58)61-17-12-16(14-9-5-2-6-10-14)18(11-15(17)13-7-3-1-4-8-13)62-38-27(51)35(59)42(36(60)28(38)52)64-40-31(55)23(47)20(44)24(48)32(40)56/h1-12H |
| InChIKey | GLDJGBULZKTBEL-UHFFFAOYSA-N |
| XLogP | 15.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 954.65 |
| LogP ≤ 5 | 15.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|