C52H61NO9 — CID 59341687
3-(4-methylphenyl)-N-[(1S)-1-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]-2-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethyl]propanamide (PubChem CID 59341687) has the molecular formula C52H61NO9 and a molecular weight of 844.06 g/mol. Its IUPAC name is 3-(4-methylphenyl)-N-[(1S)-1-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]-2-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethyl]propanamide.
| Compound Name | 3-(4-methylphenyl)-N-[(1S)-1-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]-2-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethyl]propanamide |
|---|---|
| PubChem CID | 59341687 |
| Molecular Formula | C52H61NO9 |
| Molecular Weight | 844.06 g/mol |
| Exact Mass | 843.43 |
| IUPAC Name | 3-(4-methylphenyl)-N-[(1S)-1-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]-2-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethyl]propanamide |
| SMILES | Cc1ccc(CCC(=O)N[C@@H](COC2OC(COCc3ccccc3)C(OCc3ccccc3)C(OCc3ccccc3)C2OCc2ccccc2)[C@@H]2OC(C)(C)O[C@@H]2C)cc1 |
| InChI | InChI=1S/C52H61NO9/c1-37-25-27-39(28-26-37)29-30-46(54)53-44(47-38(2)61-52(3,4)62-47)35-59-51-50(58-34-43-23-15-8-16-24-43)49(57-33-42-21-13-7-14-22-42)48(56-32-41-19-11-6-12-20-41)45(60-51)36-55-31-40-17-9-5-10-18-40/h5-28,38,44-45,47-51H,29-36H2,1-4H3,(H,53,54)/t38-,44+,45?,47-,48?,49?,50?,51?/m1/s1 |
| InChIKey | IKOXEZDRNKAHIV-BTTGGDMASA-N |
| XLogP | 8.67 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.06 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |