C32H55NO10 — CID 59341757
N-[(2S,3S,4R)-3,4-dihydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynonan-2-yl]-5-(4-hexoxyphenyl)pentanamide (PubChem CID 59341757) has the molecular formula C32H55NO10 and a molecular weight of 613.79 g/mol. Its IUPAC name is N-[(2S,3S,4R)-3,4-dihydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynonan-2-yl]-5-(4-hexoxyphenyl)pentanamide.
| Compound Name | N-[(2S,3S,4R)-3,4-dihydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynonan-2-yl]-5-(4-hexoxyphenyl)pentanamide |
|---|---|
| PubChem CID | 59341757 |
| Molecular Formula | C32H55NO10 |
| Molecular Weight | 613.79 g/mol |
| Exact Mass | 613.38 |
| IUPAC Name | N-[(2S,3S,4R)-3,4-dihydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynonan-2-yl]-5-(4-hexoxyphenyl)pentanamide |
| SMILES | CCCCCCOc1ccc(CCCCC(=O)N[C@@H](COC2OC(CO)C(O)C(O)C2O)[C@H](O)[C@H](O)CCCCC)cc1 |
| InChI | InChI=1S/C32H55NO10/c1-3-5-7-11-19-41-23-17-15-22(16-18-23)12-9-10-14-27(36)33-24(28(37)25(35)13-8-6-4-2)21-42-32-31(40)30(39)29(38)26(20-34)43-32/h15-18,24-26,28-32,34-35,37-40H,3-14,19-21H2,1-2H3,(H,33,36)/t24-,25+,26?,28-,29?,30?,31?,32?/m0/s1 |
| InChIKey | QWFZJQOOSCRHOG-FQJHIVMCSA-N |
| XLogP | 1.96 |
| TPSA | 178.17 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.79 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|