C40H33NO9 — CID 59341758
N-[(2S,3S,4R)-5-cyclopentyl-3,4-dihydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentan-2-yl]tetracosa-2,4,6,8,10,12,14,16,18,20,22-undecaynamide (PubChem CID 59341758) has the molecular formula C40H33NO9 and a molecular weight of 671.70 g/mol. Its IUPAC name is N-[(2S,3S,4R)-5-cyclopentyl-3,4-dihydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentan-2-yl]tetracosa-2,4,6,8,10,12,14,16,18,20,22-undecaynamide.
| Compound Name | N-[(2S,3S,4R)-5-cyclopentyl-3,4-dihydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentan-2-yl]tetracosa-2,4,6,8,10,12,14,16,18,20,22-undecaynamide |
|---|---|
| PubChem CID | 59341758 |
| Molecular Formula | C40H33NO9 |
| Molecular Weight | 671.70 g/mol |
| Exact Mass | 671.22 |
| IUPAC Name | N-[(2S,3S,4R)-5-cyclopentyl-3,4-dihydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentan-2-yl]tetracosa-2,4,6,8,10,12,14,16,18,20,22-undecaynamide |
| SMILES | CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC(=O)N[C@@H](COC1OC(CO)C(O)C(O)C1O)[C@H](O)[C@H](O)CC1CCCC1 |
| InChI | InChI=1S/C40H33NO9/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-27-35(44)41-32(36(45)33(43)28-31-25-23-24-26-31)30-49-40-39(48)38(47)37(46)34(29-42)50-40/h31-34,36-40,42-43,45-48H,23-26,28-30H2,1H3,(H,41,44)/t32-,33+,34?,36-,37?,38?,39?,40?/m0/s1 |
| InChIKey | LUKGVEDZGBXFRD-PKCSCDSPSA-N |
| XLogP | -2.35 |
| TPSA | 168.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.70 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|