About 3-(2,3-dihydro-1-benzofuran-5-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine
3-(2,3-dihydro-1-benzofuran-5-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine (PubChem CID 59341790) has the molecular formula C17H15N7O
and a molecular weight of 333.36 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzofuran-5-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine.
Molecular Properties
| Compound Name | 3-(2,3-dihydro-1-benzofuran-5-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine |
| PubChem CID | 59341790 |
| Molecular Formula | C17H15N7O |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 3-(2,3-dihydro-1-benzofuran-5-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine |
| SMILES | Cn1cc(-c2cnc3nnn(Cc4ccc5c(c4)CCO5)c3n2)cn1 |
| InChI | InChI=1S/C17H15N7O/c1-23-10-13(7-19-23)14-8-18-16-17(20-14)24(22-21-16)9-11-2-3-15-12(6-11)4-5-25-15/h2-3,6-8,10H,4-5,9H2,1H3 |
| InChIKey | RDULYZJLNXXKAK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 83.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-(2,3-dihydro-1-benzofuran-5-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydro-1-benzofuran-5-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine?
The IUPAC name of 3-(2,3-dihydro-1-benzofuran-5-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine (CID 59341790) is 3-(2,3-dihydro-1-benzofuran-5-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine.
What is the SMILES notation for 3-(2,3-dihydro-1-benzofuran-5-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine?
The canonical SMILES for 3-(2,3-dihydro-1-benzofuran-5-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine is Cn1cc(-c2cnc3nnn(Cc4ccc5c(c4)CCO5)c3n2)cn1.
What is the InChIKey of 3-(2,3-dihydro-1-benzofuran-5-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine?
The InChIKey is RDULYZJLNXXKAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N7O/c1-23-10-13(7-19-23)14-8-18-16-17(20-14)24(22-21-16)9-11-2-3-15-12(6-11)4-5-25-15/h2-3,6-8,10H,4-5,9H2,1H3.
What are the key properties of 3-(2,3-dihydro-1-benzofuran-5-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine?
3-(2,3-dihydro-1-benzofuran-5-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine has a molecular weight of 333.36 g/mol, XLogP of 1.61, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydro-1-benzofuran-5-ylmethyl)-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine is sourced from PubChem (CID 59341790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).